C19H19N3O6S — CID 154858775
5-(dimethylsulfamoyl)-N-[4-(furan-2-carbonylamino)-3-methylphenyl]furan-2-carboxamide (PubChem CID 154858775) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[4-(furan-2-carbonylamino)-3-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[4-(furan-2-carbonylamino)-3-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 154858775 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[4-(furan-2-carbonylamino)-3-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(S(=O)(=O)N(C)C)o2)ccc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H19N3O6S/c1-12-11-13(6-7-14(12)21-18(23)15-5-4-10-27-15)20-19(24)16-8-9-17(28-16)29(25,26)22(2)3/h4-11H,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | AVCOPZFOIJOUAY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |