C19H20IN5 — CID 15485911
1-[5-(4-iodophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-4-methylpiperazine (PubChem CID 15485911) has the molecular formula C19H20IN5 and a molecular weight of 445.31 g/mol. Its IUPAC name is 1-[5-(4-iodophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-4-methylpiperazine.
| Compound Name | 1-[5-(4-iodophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 15485911 |
| Molecular Formula | C19H20IN5 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 1-[5-(4-iodophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-4-methylpiperazine |
| SMILES | CN1CCN(c2n[nH]c(-c3ccc(I)cc3)c2-c2ccncc2)CC1 |
| InChI | InChI=1S/C19H20IN5/c1-24-10-12-25(13-11-24)19-17(14-6-8-21-9-7-14)18(22-23-19)15-2-4-16(20)5-3-15/h2-9H,10-13H2,1H3,(H,22,23) |
| InChIKey | YUEVHUUUBMFXML-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|