C17H20N2O4 — CID 154859461
1-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-oxopropyl]pyrrolidine-2,5-dione (PubChem CID 154859461) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-oxopropyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-oxopropyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154859461 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-3-oxopropyl]pyrrolidine-2,5-dione |
| SMILES | CC1CN(C(=O)CCN2C(=O)CCC2=O)Cc2ccccc2O1 |
| InChI | InChI=1S/C17H20N2O4/c1-12-10-18(11-13-4-2-3-5-14(13)23-12)15(20)8-9-19-16(21)6-7-17(19)22/h2-5,12H,6-11H2,1H3 |
| InChIKey | YWYXASHDVVVCMM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|