C27H22ClN3O4 — CID 154859724
2-(2-chlorophenyl)-1,3-dioxo-N-[1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl]isoindole-5-carboxamide (PubChem CID 154859724) has the molecular formula C27H22ClN3O4 and a molecular weight of 487.94 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1,3-dioxo-N-[1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl]isoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-1,3-dioxo-N-[1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 154859724 |
| Molecular Formula | C27H22ClN3O4 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-(2-chlorophenyl)-1,3-dioxo-N-[1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl]isoindole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C27H22ClN3O4/c1-16(17-8-11-19(12-9-17)30-14-4-7-24(30)32)29-25(33)18-10-13-20-21(15-18)27(35)31(26(20)34)23-6-3-2-5-22(23)28/h2-3,5-6,8-13,15-16H,4,7,14H2,1H3,(H,29,33) |
| InChIKey | SAFDMNUNKGMBEL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|