C8H11N3O2S — CID 154859786
3-(thiomorpholine-4-carbonyl)-1,4-dihydropyrazol-5-one (PubChem CID 154859786) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-(thiomorpholine-4-carbonyl)-1,4-dihydropyrazol-5-one.
| Compound Name | 3-(thiomorpholine-4-carbonyl)-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 154859786 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(thiomorpholine-4-carbonyl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(C(=O)N2CCSCC2)=NN1 |
| InChI | InChI=1S/C8H11N3O2S/c12-7-5-6(9-10-7)8(13)11-1-3-14-4-2-11/h1-5H2,(H,10,12) |
| InChIKey | NGCIBBIBGJAGGE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |