C16H20N4S — CID 154859937
N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 154859937) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 154859937 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | c1ccc(-c2nsc(NCC34CCCN3CCC4)n2)cc1 |
| InChI | InChI=1S/C16H20N4S/c1-2-6-13(7-3-1)14-18-15(21-19-14)17-12-16-8-4-10-20(16)11-5-9-16/h1-3,6-7H,4-5,8-12H2,(H,17,18,19) |
| InChIKey | UYOXNTYNZXXGGX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |