C16H20FN5O3S — CID 154860497
1-(5-cyclopentyl-1H-pyrazol-3-yl)-3-[4-fluoro-3-(methylsulfamoyl)phenyl]urea (PubChem CID 154860497) has the molecular formula C16H20FN5O3S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(5-cyclopentyl-1H-pyrazol-3-yl)-3-[4-fluoro-3-(methylsulfamoyl)phenyl]urea.
| Compound Name | 1-(5-cyclopentyl-1H-pyrazol-3-yl)-3-[4-fluoro-3-(methylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 154860497 |
| Molecular Formula | C16H20FN5O3S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-(5-cyclopentyl-1H-pyrazol-3-yl)-3-[4-fluoro-3-(methylsulfamoyl)phenyl]urea |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)Nc2cc(C3CCCC3)[nH]n2)ccc1F |
| InChI | InChI=1S/C16H20FN5O3S/c1-18-26(24,25)14-8-11(6-7-12(14)17)19-16(23)20-15-9-13(21-22-15)10-4-2-3-5-10/h6-10,18H,2-5H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | JAWCEJBFFCBKBY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |