About 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile
2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile (PubChem CID 154860586) has the molecular formula C20H15N3O3
and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile |
| PubChem CID | 154860586 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile |
| SMILES | COc1cccc2[nH]cc(CC(=O)C(C#N)c3nc4ccccc4o3)c12 |
| InChI | InChI=1S/C20H15N3O3/c1-25-18-8-4-6-15-19(18)12(11-22-15)9-16(24)13(10-21)20-23-14-5-2-3-7-17(14)26-20/h2-8,11,13,22H,9H2,1H3 |
| InChIKey | JSWJVBCRLHGLLP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile?
The IUPAC name of 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile (CID 154860586) is 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile.
What is the SMILES notation for 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile?
The canonical SMILES for 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile is COc1cccc2[nH]cc(CC(=O)C(C#N)c3nc4ccccc4o3)c12.
What is the InChIKey of 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile?
The InChIKey is JSWJVBCRLHGLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3/c1-25-18-8-4-6-15-19(18)12(11-22-15)9-16(24)13(10-21)20-23-14-5-2-3-7-17(14)26-20/h2-8,11,13,22H,9H2,1H3.
What are the key properties of 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile?
2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile has a molecular weight of 345.36 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-yl)-4-(4-methoxy-1H-indol-3-yl)-3-oxobutanenitrile is sourced from PubChem (CID 154860586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).