C22H17N3O4S — CID 154861779
6-[(3-naphthalen-1-yl-2,5-dihydropyrrol-1-yl)sulfonyl]-1H-quinazoline-2,4-dione (PubChem CID 154861779) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is 6-[(3-naphthalen-1-yl-2,5-dihydropyrrol-1-yl)sulfonyl]-1H-quinazoline-2,4-dione.
| Compound Name | 6-[(3-naphthalen-1-yl-2,5-dihydropyrrol-1-yl)sulfonyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 154861779 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 6-[(3-naphthalen-1-yl-2,5-dihydropyrrol-1-yl)sulfonyl]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CC=C(c4cccc5ccccc45)C3)ccc2[nH]1 |
| InChI | InChI=1S/C22H17N3O4S/c26-21-19-12-16(8-9-20(19)23-22(27)24-21)30(28,29)25-11-10-15(13-25)18-7-3-5-14-4-1-2-6-17(14)18/h1-10,12H,11,13H2,(H2,23,24,26,27) |
| InChIKey | SMDSUKAITLVGLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |