C33H28F3NO2 — CID 15486203
2,2,2-trifluoro-1-[2-phenyl-6-(trityloxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 15486203) has the molecular formula C33H28F3NO2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-phenyl-6-(trityloxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-phenyl-6-(trityloxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 15486203 |
| Molecular Formula | C33H28F3NO2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-phenyl-6-(trityloxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | O=C(N1C(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C=CCC1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H28F3NO2/c34-33(35,36)31(38)37-29(22-13-23-30(37)25-14-5-1-6-15-25)24-39-32(26-16-7-2-8-17-26,27-18-9-3-10-19-27)28-20-11-4-12-21-28/h1-22,29-30H,23-24H2 |
| InChIKey | VWMBAOLEGGZEIF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|