About [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol
[1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol (PubChem CID 154863566) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol |
| PubChem CID | 154863566 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol |
| SMILES | OCC1CN(Cc2cc(-c3ccccc3)on2)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O2/c22-13-15-11-21(18-9-5-4-8-17(15)18)12-16-10-19(23-20-16)14-6-2-1-3-7-14/h1-10,15,22H,11-13H2 |
| InChIKey | KBJOUKGJUVWICQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol?
The IUPAC name of [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol (CID 154863566) is [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol.
What is the SMILES notation for [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol?
The canonical SMILES for [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol is OCC1CN(Cc2cc(-c3ccccc3)on2)c2ccccc21.
What is the InChIKey of [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol?
The InChIKey is KBJOUKGJUVWICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c22-13-15-11-21(18-9-5-4-8-17(15)18)12-16-10-19(23-20-16)14-6-2-1-3-7-14/h1-10,15,22H,11-13H2.
What are the key properties of [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol?
[1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol has a molecular weight of 306.37 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,3-dihydroindol-3-yl]methanol is sourced from PubChem (CID 154863566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).