C17H17ClFNO3 — CID 154863739
3-chloro-N-[1-(2-fluorophenyl)-1-hydroxybutan-2-yl]-2-hydroxybenzamide (PubChem CID 154863739) has the molecular formula C17H17ClFNO3 and a molecular weight of 337.78 g/mol. Its IUPAC name is 3-chloro-N-[1-(2-fluorophenyl)-1-hydroxybutan-2-yl]-2-hydroxybenzamide.
| Compound Name | 3-chloro-N-[1-(2-fluorophenyl)-1-hydroxybutan-2-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 154863739 |
| Molecular Formula | C17H17ClFNO3 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-chloro-N-[1-(2-fluorophenyl)-1-hydroxybutan-2-yl]-2-hydroxybenzamide |
| SMILES | CCC(NC(=O)c1cccc(Cl)c1O)C(O)c1ccccc1F |
| InChI | InChI=1S/C17H17ClFNO3/c1-2-14(16(22)10-6-3-4-9-13(10)19)20-17(23)11-7-5-8-12(18)15(11)21/h3-9,14,16,21-22H,2H2,1H3,(H,20,23) |
| InChIKey | PCMMYGPAYRLSIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |