About 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide
4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide (PubChem CID 154863965) has the molecular formula C15H10FN5OS
and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide |
| PubChem CID | 154863965 |
| Molecular Formula | C15H10FN5OS |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1-c1nccs1)c1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C15H10FN5OS/c16-9-2-1-3-10-12(9)8(6-18-10)14(22)20-11-7-19-21-13(11)15-17-4-5-23-15/h1-7,18H,(H,19,21)(H,20,22) |
| InChIKey | TUTZACUCNHDQQD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide?
The IUPAC name of 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide (CID 154863965) is 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide.
What is the SMILES notation for 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide?
The canonical SMILES for 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide is O=C(Nc1cn[nH]c1-c1nccs1)c1c[nH]c2cccc(F)c12.
What is the InChIKey of 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide?
The InChIKey is TUTZACUCNHDQQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN5OS/c16-9-2-1-3-10-12(9)8(6-18-10)14(22)20-11-7-19-21-13(11)15-17-4-5-23-15/h1-7,18H,(H,19,21)(H,20,22).
What are the key properties of 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide?
4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide has a molecular weight of 327.34 g/mol, XLogP of 3.41, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]-1H-indole-3-carboxamide is sourced from PubChem (CID 154863965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).