About (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate
(2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate (PubChem CID 154864543) has the molecular formula C16H20F2O6S
and a molecular weight of 378.39 g/mol. Its IUPAC name is (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate.
Molecular Properties
| Compound Name | (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate |
| PubChem CID | 154864543 |
| Molecular Formula | C16H20F2O6S |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate |
| SMILES | COc1cc(C=O)c(OS(=O)(=O)CC2CCCCC2(F)F)cc1OC |
| InChI | InChI=1S/C16H20F2O6S/c1-22-14-7-11(9-19)13(8-15(14)23-2)24-25(20,21)10-12-5-3-4-6-16(12,17)18/h7-9,12H,3-6,10H2,1-2H3 |
| InChIKey | VYSRPKOTSGKKQL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate?
The IUPAC name of (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate (CID 154864543) is (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate.
What is the SMILES notation for (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate?
The canonical SMILES for (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate is COc1cc(C=O)c(OS(=O)(=O)CC2CCCCC2(F)F)cc1OC.
What is the InChIKey of (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate?
The InChIKey is VYSRPKOTSGKKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2O6S/c1-22-14-7-11(9-19)13(8-15(14)23-2)24-25(20,21)10-12-5-3-4-6-16(12,17)18/h7-9,12H,3-6,10H2,1-2H3.
What are the key properties of (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate?
(2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate has a molecular weight of 378.39 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyl-4,5-dimethoxyphenyl) (2,2-difluorocyclohexyl)methanesulfonate is sourced from PubChem (CID 154864543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).