C13H20N2O4 — CID 154865192
(2S)-1-(cyclopropanecarbonyl)-N-(oxolan-3-yloxy)pyrrolidine-2-carboxamide (PubChem CID 154865192) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2S)-1-(cyclopropanecarbonyl)-N-(oxolan-3-yloxy)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(cyclopropanecarbonyl)-N-(oxolan-3-yloxy)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154865192 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2S)-1-(cyclopropanecarbonyl)-N-(oxolan-3-yloxy)pyrrolidine-2-carboxamide |
| SMILES | O=C(NOC1CCOC1)[C@@H]1CCCN1C(=O)C1CC1 |
| InChI | InChI=1S/C13H20N2O4/c16-12(14-19-10-5-7-18-8-10)11-2-1-6-15(11)13(17)9-3-4-9/h9-11H,1-8H2,(H,14,16)/t10?,11-/m0/s1 |
| InChIKey | GWSPSEFFOWQFEQ-DTIOYNMSSA-N |
| XLogP | 0.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|