About 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide
3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide (PubChem CID 154865863) has the molecular formula C11H10FN3O3
and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide |
| PubChem CID | 154865863 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide |
| SMILES | CN1C(=O)CC(NC(=O)c2ncccc2F)C1=O |
| InChI | InChI=1S/C11H10FN3O3/c1-15-8(16)5-7(11(15)18)14-10(17)9-6(12)3-2-4-13-9/h2-4,7H,5H2,1H3,(H,14,17) |
| InChIKey | MEIZLDGDAMKECY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide?
The IUPAC name of 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide (CID 154865863) is 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide.
What is the SMILES notation for 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide?
The canonical SMILES for 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide is CN1C(=O)CC(NC(=O)c2ncccc2F)C1=O.
What is the InChIKey of 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide?
The InChIKey is MEIZLDGDAMKECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O3/c1-15-8(16)5-7(11(15)18)14-10(17)9-6(12)3-2-4-13-9/h2-4,7H,5H2,1H3,(H,14,17).
What are the key properties of 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide?
3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide has a molecular weight of 251.22 g/mol, XLogP of -0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyridine-2-carboxamide is sourced from PubChem (CID 154865863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).