C16H27N3O2 — CID 154865953
1-[4-[(3R,5S)-3-ethyl-5-methylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 154865953) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3-ethyl-5-methylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(3R,5S)-3-ethyl-5-methylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154865953 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[4-[(3R,5S)-3-ethyl-5-methylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2C[C@@H](CC)N[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-4-14-11-19(10-12(3)17-14)16(21)13-6-8-18(9-7-13)15(20)5-2/h5,12-14,17H,2,4,6-11H2,1,3H3/t12-,14+/m0/s1 |
| InChIKey | FYZIRXRVTOOCHL-GXTWGEPZSA-N |
| XLogP | 1.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|