C16H24N6O — CID 154866536
5-methyl-N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide (PubChem CID 154866536) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-methyl-N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide.
| Compound Name | 5-methyl-N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 154866536 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 5-methyl-N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
| SMILES | CC(C)c1nnc(CNC(=O)C2c3cn[nH]c3CCC2C)n1C |
| InChI | InChI=1S/C16H24N6O/c1-9(2)15-21-20-13(22(15)4)8-17-16(23)14-10(3)5-6-12-11(14)7-18-19-12/h7,9-10,14H,5-6,8H2,1-4H3,(H,17,23)(H,18,19) |
| InChIKey | FVGMTEZTTDQKIW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |