C14H16O2 — CID 15486674
4,5,6,7,8-pentamethylcyclohepta[b]furan-2-one (PubChem CID 15486674) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 4,5,6,7,8-pentamethylcyclohepta[b]furan-2-one.
| Compound Name | 4,5,6,7,8-pentamethylcyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 15486674 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4,5,6,7,8-pentamethylcyclohepta[b]furan-2-one |
| SMILES | Cc1c2cc(=O)oc-2c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H16O2/c1-7-8(2)10(4)12-6-13(15)16-14(12)11(5)9(7)3/h6H,1-5H3 |
| InChIKey | JYKHMXVLVYTELQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |