About 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide
2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 154866960) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide |
| PubChem CID | 154866960 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(N[C@@]12COC[C@@H]1C2)c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C13H15N3O3/c17-10-3-9(14-11(15-10)7-1-2-7)12(18)16-13-4-8(13)5-19-6-13/h3,7-8H,1-2,4-6H2,(H,16,18)(H,14,15,17)/t8-,13-/m0/s1 |
| InChIKey | GCMYIOARJRMTOI-SDBXPKJASA-N |
| XLogP | 0.17 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide (CID 154866960) is 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide is O=C(N[C@@]12COC[C@@H]1C2)c1cc(=O)[nH]c(C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide?
The InChIKey is GCMYIOARJRMTOI-SDBXPKJASA-N. The full InChI is InChI=1S/C13H15N3O3/c17-10-3-9(14-11(15-10)7-1-2-7)12(18)16-13-4-8(13)5-19-6-13/h3,7-8H,1-2,4-6H2,(H,16,18)(H,14,15,17)/t8-,13-/m0/s1.
What are the key properties of 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide?
2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide has a molecular weight of 261.28 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-6-oxo-1H-pyrimidine-4-carboxamide is sourced from PubChem (CID 154866960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).