About (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate
(6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 154868325) has the molecular formula C18H17F3N4O3
and a molecular weight of 394.35 g/mol. Its IUPAC name is (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate.
Molecular Properties
| Compound Name | (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate |
| PubChem CID | 154868325 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | Cc1ccc(Nc2nccc(C(F)(F)F)n2)cc1C(=O)OC1CCC(=O)NC1 |
| InChI | InChI=1S/C18H17F3N4O3/c1-10-2-3-11(24-17-22-7-6-14(25-17)18(19,20)21)8-13(10)16(27)28-12-4-5-15(26)23-9-12/h2-3,6-8,12H,4-5,9H2,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | PMBNVLVQPSSAKG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate?
The IUPAC name of (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate (CID 154868325) is (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate.
What is the SMILES notation for (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate?
The canonical SMILES for (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate is Cc1ccc(Nc2nccc(C(F)(F)F)n2)cc1C(=O)OC1CCC(=O)NC1.
What is the InChIKey of (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate?
The InChIKey is PMBNVLVQPSSAKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N4O3/c1-10-2-3-11(24-17-22-7-6-14(25-17)18(19,20)21)8-13(10)16(27)28-12-4-5-15(26)23-9-12/h2-3,6-8,12H,4-5,9H2,1H3,(H,23,26)(H,22,24,25).
What are the key properties of (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate?
(6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate has a molecular weight of 394.35 g/mol, XLogP of 2.98, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxopiperidin-3-yl) 2-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate is sourced from PubChem (CID 154868325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).