C16H19F3N2O — CID 154868569
N-[2-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 154868569) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[2-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | N-[2-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154868569 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[2-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(c1ccc(C(F)(F)F)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H19F3N2O/c1-2-15(22)20-11-14(21-9-3-4-10-21)12-5-7-13(8-6-12)16(17,18)19/h2,5-8,14H,1,3-4,9-11H2,(H,20,22) |
| InChIKey | PNDYYMUHWNGEKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|