C6H10BrN3S — CID 154868587
1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione;hydrobromide (PubChem CID 154868587) has the molecular formula C6H10BrN3S and a molecular weight of 236.14 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione;hydrobromide.
| Compound Name | 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione;hydrobromide |
|---|---|
| PubChem CID | 154868587 |
| Molecular Formula | C6H10BrN3S |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione;hydrobromide |
| SMILES | Br.S=c1[nH]c2c([nH]1)CNCC2 |
| InChI | InChI=1S/C6H9N3S.BrH/c10-6-8-4-1-2-7-3-5(4)9-6;/h7H,1-3H2,(H2,8,9,10);1H |
| InChIKey | FARIKIRTOULAKV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 43.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|