C6H9N3S — CID 154868588
1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione (PubChem CID 154868588) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 154868588 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 1,3,4,5,6,7-hexahydroimidazo[4,5-c]pyridine-2-thione |
| SMILES | S=c1[nH]c2c([nH]1)CNCC2 |
| InChI | InChI=1S/C6H9N3S/c10-6-8-4-1-2-7-3-5(4)9-6/h7H,1-3H2,(H2,8,9,10) |
| InChIKey | NDRFQPPPGGSFAP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 43.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|