About methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride
methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride (PubChem CID 154868590) has the molecular formula C10H12ClF2NO2
and a molecular weight of 251.66 g/mol. Its IUPAC name is methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride |
| PubChem CID | 154868590 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(C(F)(F)CN)cc1.Cl |
| InChI | InChI=1S/C10H11F2NO2.ClH/c1-15-9(14)7-2-4-8(5-3-7)10(11,12)6-13;/h2-5H,6,13H2,1H3;1H |
| InChIKey | AKRKBJWGBGULMS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride?
The IUPAC name of methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride (CID 154868590) is methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride.
What is the SMILES notation for methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride?
The canonical SMILES for methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride is COC(=O)c1ccc(C(F)(F)CN)cc1.Cl.
What is the InChIKey of methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride?
The InChIKey is AKRKBJWGBGULMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2.ClH/c1-15-9(14)7-2-4-8(5-3-7)10(11,12)6-13;/h2-5H,6,13H2,1H3;1H.
What are the key properties of methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride?
methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride has a molecular weight of 251.66 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-amino-1,1-difluoroethyl)benzoate;hydrochloride is sourced from PubChem (CID 154868590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).