C16H21NO4 — CID 154869230
(3aR,6aR)-5-[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154869230) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3aR,6aR)-5-[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154869230 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (3aR,6aR)-5-[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(C1[C@@H]2[C@H]3CC[C@H](C3)[C@H]12)N1C[C@@H]2COC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H21NO4/c18-14(13-11-8-1-2-9(3-8)12(11)13)17-4-10-5-21-7-16(10,6-17)15(19)20/h8-13H,1-7H2,(H,19,20)/t8-,9+,10-,11+,12-,13?,16-/m1/s1 |
| InChIKey | DCTQBXXHDJLDIZ-YCCRHIJXSA-N |
| XLogP | 0.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |