C14H20N4O2S — CID 154869840
1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-3-[(1R,2R,4R,5R)-5-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 154869840) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-3-[(1R,2R,4R,5R)-5-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-3-[(1R,2R,4R,5R)-5-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 154869840 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-3-[(1R,2R,4R,5R)-5-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | O=C(Nc1nc(C2CC2)ns1)N[C@@H]1C[C@H]2C[C@@H]1C[C@H]2CO |
| InChI | InChI=1S/C14H20N4O2S/c19-6-10-4-9-3-8(10)5-11(9)15-13(20)17-14-16-12(18-21-14)7-1-2-7/h7-11,19H,1-6H2,(H2,15,16,17,18,20)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | GDFJKGHGRSMIOP-CHWFTXMASA-N |
| XLogP | 1.94 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |