C12H15F2N3O4 — CID 154870164
[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate (PubChem CID 154870164) has the molecular formula C12H15F2N3O4 and a molecular weight of 303.27 g/mol. Its IUPAC name is [(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate.
| Compound Name | [(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 154870164 |
| Molecular Formula | C12H15F2N3O4 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | [(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCC(=O)OC[C@@H]1[C@@H](C)C1(F)F |
| InChI | InChI=1S/C12H15F2N3O4/c1-7-9(12(7,13)14)6-21-11(18)3-4-16-5-10(17(19)20)15-8(16)2/h5,7,9H,3-4,6H2,1-2H3/t7-,9-/m1/s1 |
| InChIKey | BAJHCBNTCHTMHO-VXNVDRBHSA-N |
| XLogP | 1.93 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|