C23H24N2O3 — CID 154870946
1-(2-methoxyphenyl)-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]cyclopropane-1-carboxamide (PubChem CID 154870946) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2-methoxyphenyl)-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 154870946 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-[(1R,2R)-1-(prop-2-enoylamino)-2,3-dihydro-1H-inden-2-yl]cyclopropane-1-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1c2ccccc2C[C@H]1NC(=O)C1(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-20(26)25-21-16-9-5-4-8-15(16)14-18(21)24-22(27)23(12-13-23)17-10-6-7-11-19(17)28-2/h3-11,18,21H,1,12-14H2,2H3,(H,24,27)(H,25,26)/t18-,21-/m1/s1 |
| InChIKey | KZLPCBYUDAJRSP-WIYYLYMNSA-N |
| XLogP | 2.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|