C16H19N3O3S — CID 154871131
(6S,8R)-N-(benzenesulfonyl)-2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 154871131) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (6S,8R)-N-(benzenesulfonyl)-2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | (6S,8R)-N-(benzenesulfonyl)-2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154871131 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (6S,8R)-N-(benzenesulfonyl)-2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1cn2c(n1)[C@H](C)C[C@H](C(=O)NS(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H19N3O3S/c1-11-8-13(10-19-9-12(2)17-15(11)19)16(20)18-23(21,22)14-6-4-3-5-7-14/h3-7,9,11,13H,8,10H2,1-2H3,(H,18,20)/t11-,13+/m1/s1 |
| InChIKey | RMWJCNRKSRVSPI-YPMHNXCESA-N |
| XLogP | 1.82 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |