C16H18N2O4 — CID 154871148
(5S)-3-(1,3-benzodioxol-5-yl)-5-propan-2-yl-5-prop-2-enylimidazolidine-2,4-dione (PubChem CID 154871148) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-yl)-5-propan-2-yl-5-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-yl)-5-propan-2-yl-5-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154871148 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-yl)-5-propan-2-yl-5-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CC[C@@]1(C(C)C)NC(=O)N(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-4-7-16(10(2)3)14(19)18(15(20)17-16)11-5-6-12-13(8-11)22-9-21-12/h4-6,8,10H,1,7,9H2,2-3H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | MJDLIBQKJXPYST-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|