C16H20NNaO4 — CID 154871248
sodium (1S,5R)-5-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methylcarbamoyl]bicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 154871248) has the molecular formula C16H20NNaO4 and a molecular weight of 313.33 g/mol. Its IUPAC name is sodium (1S,5R)-5-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methylcarbamoyl]bicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | sodium (1S,5R)-5-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methylcarbamoyl]bicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 154871248 |
| Molecular Formula | C16H20NNaO4 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | sodium (1S,5R)-5-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methylcarbamoyl]bicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | O=C([O-])[C@]12CCC[C@@]1(C(=O)NC[C@@H]1C[C@@H]3O[C@H]1[C@H]1C[C@H]13)C2.[Na+] |
| InChI | InChI=1S/C16H21NO4.Na/c18-13(15-2-1-3-16(15,7-15)14(19)20)17-6-8-4-11-9-5-10(9)12(8)21-11;/h8-12H,1-7H2,(H,17,18)(H,19,20);/q;+1/p-1/t8-,9+,10-,11-,12+,15-,16+;/m0./s1 |
| InChIKey | FEJSZXVIFFXFPY-TUUGFGFYSA-M |
| XLogP | -3.16 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |