C14H16N4O2S — CID 154871402
1-[(1R,2S,4S,6R)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)urea (PubChem CID 154871402) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-[(1R,2S,4S,6R)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)urea.
| Compound Name | 1-[(1R,2S,4S,6R)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 154871402 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[(1R,2S,4S,6R)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
| SMILES | O=C(Nc1nc2cccnc2s1)N[C@H]1C[C@@H]2C[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C14H16N4O2S/c19-11-6-7-4-8(11)10(5-7)16-13(20)18-14-17-9-2-1-3-15-12(9)21-14/h1-3,7-8,10-11,19H,4-6H2,(H2,16,17,18,20)/t7-,8+,10-,11+/m0/s1 |
| InChIKey | OIXDSAYZRRZNJK-GISOBZBCSA-N |
| XLogP | 1.97 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |