C16H21N3O3 — CID 154871705
trans-(1S,2S)-2-[(1R,2R)-2-[(1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl)amino]cyclopropyl]cyclopropane-1-carboxylic acid (PubChem CID 154871705) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(1R,2R)-2-[(1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl)amino]cyclopropyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[(1R,2R)-2-[(1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl)amino]cyclopropyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 154871705 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | trans-(1S,2S)-2-[(1R,2R)-2-[(1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl)amino]cyclopropyl]cyclopropane-1-carboxylic acid |
| SMILES | Cn1ncc2c1CC(C(=O)N[C@@H]1C[C@@H]1[C@@H]1C[C@@H]1C(=O)O)CC2 |
| InChI | InChI=1S/C16H21N3O3/c1-19-14-4-8(2-3-9(14)7-17-19)15(20)18-13-6-11(13)10-5-12(10)16(21)22/h7-8,10-13H,2-6H2,1H3,(H,18,20)(H,21,22)/t8?,10-,11+,12-,13+/m0/s1 |
| InChIKey | UIFNBTHAHPNYNM-FKQHRNAXSA-N |
| XLogP | 0.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |