About 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine
5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine (PubChem CID 154871800) has the molecular formula C18H21ClN2O2S
and a molecular weight of 364.90 g/mol. Its IUPAC name is 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine |
| PubChem CID | 154871800 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine |
| SMILES | Cc1ccc(Cl)c2ccc(NCC3CC34CCS(=O)(=O)CC4)nc12 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-12-2-4-15(19)14-3-5-16(21-17(12)14)20-11-13-10-18(13)6-8-24(22,23)9-7-18/h2-5,13H,6-11H2,1H3,(H,20,21) |
| InChIKey | YXKMGNNOBLFJOI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine?
The IUPAC name of 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine (CID 154871800) is 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine.
What is the SMILES notation for 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine?
The canonical SMILES for 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine is Cc1ccc(Cl)c2ccc(NCC3CC34CCS(=O)(=O)CC4)nc12.
What is the InChIKey of 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine?
The InChIKey is YXKMGNNOBLFJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O2S/c1-12-2-4-15(19)14-3-5-16(21-17(12)14)20-11-13-10-18(13)6-8-24(22,23)9-7-18/h2-5,13H,6-11H2,1H3,(H,20,21).
What are the key properties of 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine?
5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine has a molecular weight of 364.90 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(6,6-dioxo-6λ6-thiaspiro[2.5]octan-2-yl)methyl]-8-methylquinolin-2-amine is sourced from PubChem (CID 154871800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).