C18H22FN3O — CID 154872118
(E)-4-(dimethylamino)-1-(9-fluoro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indol-2-yl)but-2-en-1-one (PubChem CID 154872118) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-(9-fluoro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indol-2-yl)but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-(9-fluoro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indol-2-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 154872118 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (E)-4-(dimethylamino)-1-(9-fluoro-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indol-2-yl)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C18H22FN3O/c1-21(2)9-4-6-18(23)22-10-3-5-16-15(12-22)14-11-13(19)7-8-17(14)20-16/h4,6-8,11,20H,3,5,9-10,12H2,1-2H3/b6-4+ |
| InChIKey | OKGLKSQNRUTUAT-GQCTYLIASA-N |
| XLogP | 2.70 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|