C28H26FN3O2 — CID 15487213
[4-[4-[2-(4-fluorophenyl)ethyl]piperazine-1-carbonyl]-1H-indol-3-yl]-phenylmethanone (PubChem CID 15487213) has the molecular formula C28H26FN3O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is [4-[4-[2-(4-fluorophenyl)ethyl]piperazine-1-carbonyl]-1H-indol-3-yl]-phenylmethanone.
| Compound Name | [4-[4-[2-(4-fluorophenyl)ethyl]piperazine-1-carbonyl]-1H-indol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15487213 |
| Molecular Formula | C28H26FN3O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [4-[4-[2-(4-fluorophenyl)ethyl]piperazine-1-carbonyl]-1H-indol-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c[nH]c2cccc(C(=O)N3CCN(CCc4ccc(F)cc4)CC3)c12 |
| InChI | InChI=1S/C28H26FN3O2/c29-22-11-9-20(10-12-22)13-14-31-15-17-32(18-16-31)28(34)23-7-4-8-25-26(23)24(19-30-25)27(33)21-5-2-1-3-6-21/h1-12,19,30H,13-18H2 |
| InChIKey | CYMVPVNLUKFMDV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |