C20H25ClN2O3 — CID 154874701
2-chloro-N-[2-[1-(5,6-dimethyl-1-benzofuran-3-carbonyl)piperidin-4-yl]ethyl]acetamide (PubChem CID 154874701) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(5,6-dimethyl-1-benzofuran-3-carbonyl)piperidin-4-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[1-(5,6-dimethyl-1-benzofuran-3-carbonyl)piperidin-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 154874701 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-chloro-N-[2-[1-(5,6-dimethyl-1-benzofuran-3-carbonyl)piperidin-4-yl]ethyl]acetamide |
| SMILES | Cc1cc2occ(C(=O)N3CCC(CCNC(=O)CCl)CC3)c2cc1C |
| InChI | InChI=1S/C20H25ClN2O3/c1-13-9-16-17(12-26-18(16)10-14(13)2)20(25)23-7-4-15(5-8-23)3-6-22-19(24)11-21/h9-10,12,15H,3-8,11H2,1-2H3,(H,22,24) |
| InChIKey | NGLIXBCTKFNOJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|