C20H29ClN2O3 — CID 154874827
2-chloro-N-[[1-[3-(2,5-dimethylphenoxy)propanoyl]-4-methylpiperidin-3-yl]methyl]acetamide (PubChem CID 154874827) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-chloro-N-[[1-[3-(2,5-dimethylphenoxy)propanoyl]-4-methylpiperidin-3-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[1-[3-(2,5-dimethylphenoxy)propanoyl]-4-methylpiperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 154874827 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-chloro-N-[[1-[3-(2,5-dimethylphenoxy)propanoyl]-4-methylpiperidin-3-yl]methyl]acetamide |
| SMILES | Cc1ccc(C)c(OCCC(=O)N2CCC(C)C(CNC(=O)CCl)C2)c1 |
| InChI | InChI=1S/C20H29ClN2O3/c1-14-4-5-16(3)18(10-14)26-9-7-20(25)23-8-6-15(2)17(13-23)12-22-19(24)11-21/h4-5,10,15,17H,6-9,11-13H2,1-3H3,(H,22,24) |
| InChIKey | JCGYYOZLCHFWAX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|