C24H28N2O2 — CID 154875394
N-[1-[4-[[[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]methyl]phenyl]ethyl]prop-2-enamide (PubChem CID 154875394) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[1-[4-[[[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]methyl]phenyl]ethyl]prop-2-enamide.
| Compound Name | N-[1-[4-[[[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]methyl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154875394 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[1-[4-[[[2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetyl]amino]methyl]phenyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1ccc(CNC(=O)Cc2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-23(27)26-17(2)20-11-8-18(9-12-20)16-25-24(28)15-19-10-13-21-6-4-5-7-22(21)14-19/h3,8-14,17H,1,4-7,15-16H2,2H3,(H,25,28)(H,26,27) |
| InChIKey | BZYFDEIMEGCUBE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|