About methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate
methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate (PubChem CID 15487552) has the molecular formula C13H16F3NO2
and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate |
| PubChem CID | 15487552 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate |
| SMILES | COC(=O)[C@@H](CC(F)(F)F)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H16F3NO2/c1-17(9-10-6-4-3-5-7-10)11(12(18)19-2)8-13(14,15)16/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | KHWQRLZDVTZAPH-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate?
The IUPAC name of methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate (CID 15487552) is methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate.
What is the SMILES notation for methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate?
The canonical SMILES for methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate is COC(=O)[C@@H](CC(F)(F)F)N(C)Cc1ccccc1.
What is the InChIKey of methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate?
The InChIKey is KHWQRLZDVTZAPH-LLVKDONJSA-N. The full InChI is InChI=1S/C13H16F3NO2/c1-17(9-10-6-4-3-5-7-10)11(12(18)19-2)8-13(14,15)16/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1.
What are the key properties of methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate?
methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate has a molecular weight of 275.27 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[benzyl(methyl)amino]-4,4,4-trifluorobutanoate is sourced from PubChem (CID 15487552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).