About 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol
1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol (PubChem CID 154875879) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol.
Molecular Properties
| Compound Name | 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol |
| PubChem CID | 154875879 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol |
| SMILES | CS1(=O)=NCc2cc(O)ccc21 |
| InChI | InChI=1S/C8H9NO2S/c1-12(11)8-3-2-7(10)4-6(8)5-9-12/h2-4,10H,5H2,1H3 |
| InChIKey | SRRHQGVMXNEDMW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol?
The IUPAC name of 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol (CID 154875879) is 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol.
What is the SMILES notation for 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol?
The canonical SMILES for 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol is CS1(=O)=NCc2cc(O)ccc21.
What is the InChIKey of 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol?
The InChIKey is SRRHQGVMXNEDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c1-12(11)8-3-2-7(10)4-6(8)5-9-12/h2-4,10H,5H2,1H3.
What are the key properties of 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol?
1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol has a molecular weight of 183.23 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-oxo-3H-1,2-benzothiazol-5-ol is sourced from PubChem (CID 154875879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).