C16H27F3N2O — CID 154876650
(3aR,6aR)-N-(4,4-dimethylpentan-2-yl)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 154876650) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is (3aR,6aR)-N-(4,4-dimethylpentan-2-yl)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aR)-N-(4,4-dimethylpentan-2-yl)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154876650 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (3aR,6aR)-N-(4,4-dimethylpentan-2-yl)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CC(CC(C)(C)C)NC(=O)N1C[C@@H]2CCC[C@]2(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H27F3N2O/c1-11(8-14(2,3)4)20-13(22)21-9-12-6-5-7-15(12,10-21)16(17,18)19/h11-12H,5-10H2,1-4H3,(H,20,22)/t11?,12-,15-/m0/s1 |
| InChIKey | CVJUPVIXGVJTMA-LBBQAWJBSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |