C23H24F3N3O3 — CID 154877689
5-oxo-N-(1,1,1-trifluoro-3-phenylpropan-2-yl)spiro[3,4-dihydro-1,4-benzoxazepine-2,4'-piperidine]-1'-carboxamide (PubChem CID 154877689) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is 5-oxo-N-(1,1,1-trifluoro-3-phenylpropan-2-yl)spiro[3,4-dihydro-1,4-benzoxazepine-2,4'-piperidine]-1'-carboxamide.
| Compound Name | 5-oxo-N-(1,1,1-trifluoro-3-phenylpropan-2-yl)spiro[3,4-dihydro-1,4-benzoxazepine-2,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 154877689 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-oxo-N-(1,1,1-trifluoro-3-phenylpropan-2-yl)spiro[3,4-dihydro-1,4-benzoxazepine-2,4'-piperidine]-1'-carboxamide |
| SMILES | O=C1NCC2(CCN(C(=O)NC(Cc3ccccc3)C(F)(F)F)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C23H24F3N3O3/c24-23(25,26)19(14-16-6-2-1-3-7-16)28-21(31)29-12-10-22(11-13-29)15-27-20(30)17-8-4-5-9-18(17)32-22/h1-9,19H,10-15H2,(H,27,30)(H,28,31) |
| InChIKey | YJVMVOVBEZFIIA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |