About 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine
5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 154877843) has the molecular formula C19H19N5S
and a molecular weight of 349.46 g/mol. Its IUPAC name is 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 154877843 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(NCCn3cncc3-c3ccccc3)c2c1C |
| InChI | InChI=1S/C19H19N5S/c1-13-14(2)25-19-17(13)18(22-11-23-19)21-8-9-24-12-20-10-16(24)15-6-4-3-5-7-15/h3-7,10-12H,8-9H2,1-2H3,(H,21,22,23) |
| InChIKey | HEOJKRCKHUURHM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine (CID 154877843) is 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine is Cc1sc2ncnc(NCCn3cncc3-c3ccccc3)c2c1C.
What is the InChIKey of 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is HEOJKRCKHUURHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5S/c1-13-14(2)25-19-17(13)18(22-11-23-19)21-8-9-24-12-20-10-16(24)15-6-4-3-5-7-15/h3-7,10-12H,8-9H2,1-2H3,(H,21,22,23).
What are the key properties of 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 349.46 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-N-[2-(5-phenylimidazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 154877843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).