C28H40N6O7S — CID 15487871
(2S)-2-amino-3-(4-hydroxyphenyl)-N-[2-[[2-[[(2S)-1-[[(2S)-4-methyl-1-sulfamoylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]propanamide (PubChem CID 15487871) has the molecular formula C28H40N6O7S and a molecular weight of 604.73 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)-N-[2-[[2-[[(2S)-1-[[(2S)-4-methyl-1-sulfamoylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[2-[[2-[[(2S)-1-[[(2S)-4-methyl-1-sulfamoylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 15487871 |
| Molecular Formula | C28H40N6O7S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[2-[[2-[[(2S)-1-[[(2S)-4-methyl-1-sulfamoylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]propanamide |
| SMILES | CC(C)C[C@@H](CS(N)(=O)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C28H40N6O7S/c1-18(2)12-21(17-42(30,40)41)33-28(39)24(14-19-6-4-3-5-7-19)34-26(37)16-31-25(36)15-32-27(38)23(29)13-20-8-10-22(35)11-9-20/h3-11,18,21,23-24,35H,12-17,29H2,1-2H3,(H,31,36)(H,32,38)(H,33,39)(H,34,37)(H2,30,40,41)/t21-,23-,24-/m0/s1 |
| InChIKey | SCRRFMBDOXLAHG-XWGVYQGASA-N |
| XLogP | -0.96 |
| TPSA | 222.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |