C28H18BrN3O2 — CID 154879293
4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-ylmethyl)benzoic acid bromide (PubChem CID 154879293) has the molecular formula C28H18BrN3O2 and a molecular weight of 508.38 g/mol. Its IUPAC name is 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-ylmethyl)benzoic acid bromide.
| Compound Name | 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-ylmethyl)benzoic acid bromide |
|---|---|
| PubChem CID | 154879293 |
| Molecular Formula | C28H18BrN3O2 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-ylmethyl)benzoic acid bromide |
| SMILES | O=C(O)c1ccc(C[n+]2c3ccccc3n3nc4c(cc32)c2cccc3cccc4c32)cc1.[Br-] |
| InChI | InChI=1S/C28H17N3O2.BrH/c32-28(33)19-13-11-17(12-14-19)16-30-23-9-1-2-10-24(23)31-25(30)15-22-20-7-3-5-18-6-4-8-21(26(18)20)27(22)29-31;/h1-15H,16H2;1H |
| InChIKey | NJPMQCHOPVIAEK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|