C10H14IN3 — CID 154879321
1,3,6-trimethyl-4H-pyrido[2,1-c][1,2,4]triazin-5-ium iodide (PubChem CID 154879321) has the molecular formula C10H14IN3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 1,3,6-trimethyl-4H-pyrido[2,1-c][1,2,4]triazin-5-ium iodide.
| Compound Name | 1,3,6-trimethyl-4H-pyrido[2,1-c][1,2,4]triazin-5-ium iodide |
|---|---|
| PubChem CID | 154879321 |
| Molecular Formula | C10H14IN3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1,3,6-trimethyl-4H-pyrido[2,1-c][1,2,4]triazin-5-ium iodide |
| SMILES | CC1=NN(C)c2cccc(C)[n+]2C1.[I-] |
| InChI | InChI=1S/C10H14N3.HI/c1-8-7-13-9(2)5-4-6-10(13)12(3)11-8;/h4-6H,7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IGYTWUOEDFACSG-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|