C15H22N6O — CID 154879384
N-(cyanomethyl)-4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5,6-dimethylpyrimidine-2-carboxamide (PubChem CID 154879384) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5,6-dimethylpyrimidine-2-carboxamide.
| Compound Name | N-(cyanomethyl)-4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5,6-dimethylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 154879384 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-(cyanomethyl)-4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5,6-dimethylpyrimidine-2-carboxamide |
| SMILES | Cc1nc(C(=O)NCC#N)nc(N2CC[C@@H](N(C)C)C2)c1C |
| InChI | InChI=1S/C15H22N6O/c1-10-11(2)18-13(15(22)17-7-6-16)19-14(10)21-8-5-12(9-21)20(3)4/h12H,5,7-9H2,1-4H3,(H,17,22)/t12-/m1/s1 |
| InChIKey | MWHMTPFUOMUKLB-GFCCVEGCSA-N |
| XLogP | 0.49 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|