C14H17NO4 — CID 154880267
N-[[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]methyl]oxirane-2-carboxamide (PubChem CID 154880267) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is N-[[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]methyl]oxirane-2-carboxamide.
| Compound Name | N-[[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]methyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 154880267 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-[[3-(2-methyl-1,3-dioxolan-2-yl)phenyl]methyl]oxirane-2-carboxamide |
| SMILES | CC1(c2cccc(CNC(=O)C3CO3)c2)OCCO1 |
| InChI | InChI=1S/C14H17NO4/c1-14(18-5-6-19-14)11-4-2-3-10(7-11)8-15-13(16)12-9-17-12/h2-4,7,12H,5-6,8-9H2,1H3,(H,15,16) |
| InChIKey | PCMAVASMIIFQEP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|